sin 60° × cos 30° + sin 30° × cos 60° का मान है:
उत्तर: (B) 1 — = (√3/2)(√3/2) + (1/2)(1/2) = 3/4 + 1/4 = 1. This is actually sin(60°+30°) = sin90° = 1 using the formula sin(A+B)=sinAcosB+cosAsinB.
Level 2Medium
sin 60° × cos 30° + sin 30° × cos 60° का मान है:
संबंधित REET प्रश्न
sin 30° + cos 60° का मान है:
Trigonometric Values of Standard AnglesMathematics
cos²θ + sin²θ का मान है:
Trigonometric Values of Standard AnglesMathematics
दो पासों (dice) को एक साथ फेंकने पर कुल परिणामों (outcomes) की संख्या है:
ProbabilityMathematics
√2 किस प्रकार की संख्या है?
Number SystemMathematics
विटामिन D का मुख्य स्रोत क्या है?
Vitamin D Synthesis and SunlightScience
Trigonometric Values of Standard Angles के सभी प्रश्न देखें
विषय देखें →